C15H13Cl2NO3S — CID 8509645
N-[[5-[2-(3,4-dichlorophenoxy)acetyl]thiophen-2-yl]methyl]acetamide (PubChem CID 8509645) has the molecular formula C15H13Cl2NO3S and a molecular weight of 358.25 g/mol. Its IUPAC name is N-[[5-[2-(3,4-dichlorophenoxy)acetyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-(3,4-dichlorophenoxy)acetyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 8509645 |
| Molecular Formula | C15H13Cl2NO3S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-[[5-[2-(3,4-dichlorophenoxy)acetyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)COc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C15H13Cl2NO3S/c1-9(19)18-7-11-3-5-15(22-11)14(20)8-21-10-2-4-12(16)13(17)6-10/h2-6H,7-8H2,1H3,(H,18,19) |
| InChIKey | RRVTVMBEDFXASF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |