C21H30N2O3 — CID 2579840
3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-5,5-dipropylimidazolidine-2,4-dione (PubChem CID 2579840) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-5,5-dipropylimidazolidine-2,4-dione.
| Compound Name | 3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-5,5-dipropylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2579840 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-5,5-dipropylimidazolidine-2,4-dione |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)c2c(C)c(C)cc(C)c2C)C1=O |
| InChI | InChI=1S/C21H30N2O3/c1-7-9-21(10-8-2)19(25)23(20(26)22-21)12-17(24)18-15(5)13(3)11-14(4)16(18)6/h11H,7-10,12H2,1-6H3,(H,22,26) |
| InChIKey | WWYJODLTQPAAIK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|