C19H27N3O5S — CID 7594741
N-[4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]phenyl]-N-methylmethanesulfonamide (PubChem CID 7594741) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 7594741 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-[4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]phenyl]-N-methylmethanesulfonamide |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)c2ccc(N(C)S(C)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C19H27N3O5S/c1-5-11-19(12-6-2)17(24)22(18(25)20-19)13-16(23)14-7-9-15(10-8-14)21(3)28(4,26)27/h7-10H,5-6,11-13H2,1-4H3,(H,20,25) |
| InChIKey | JMPZRSBVNCULOT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|