C25H27N3O3 — CID 42984126
3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-5,5-dipropylimidazolidine-2,4-dione (PubChem CID 42984126) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-5,5-dipropylimidazolidine-2,4-dione.
| Compound Name | 3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-5,5-dipropylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42984126 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-5,5-dipropylimidazolidine-2,4-dione |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)c2c(-c3ccccc3)[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C25H27N3O3/c1-3-14-25(15-4-2)23(30)28(24(31)27-25)16-20(29)21-18-12-8-9-13-19(18)26-22(21)17-10-6-5-7-11-17/h5-13,26H,3-4,14-16H2,1-2H3,(H,27,31) |
| InChIKey | GTOAWHUOEXPIJX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|