C24H23N3O3 — CID 4884583
3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 4884583) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 4884583 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H23N3O3/c28-19(15-27-22(29)24(26-23(27)30)13-7-2-8-14-24)20-17-11-5-6-12-18(17)25-21(20)16-9-3-1-4-10-16/h1,3-6,9-12,25H,2,7-8,13-15H2,(H,26,30) |
| InChIKey | ORPJWPOTFFMKCM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|