C20H29N3O5 — CID 51309764
ethyl 4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 51309764) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl 4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 51309764 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl 4-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)c2c(C)[nH]c(C(=O)OCC)c2C)C1=O |
| InChI | InChI=1S/C20H29N3O5/c1-6-9-20(10-7-2)18(26)23(19(27)22-20)11-14(24)15-12(4)16(21-13(15)5)17(25)28-8-3/h21H,6-11H2,1-5H3,(H,22,27) |
| InChIKey | WEGFAOPEVOCZLG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|