C20H20N2O — CID 9033533
1-(2-phenyl-1H-indol-3-yl)-2-pyrrolidin-1-ylethanone (PubChem CID 9033533) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(2-phenyl-1H-indol-3-yl)-2-pyrrolidin-1-ylethanone.
| Compound Name | 1-(2-phenyl-1H-indol-3-yl)-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 9033533 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-(2-phenyl-1H-indol-3-yl)-2-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCCC1)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O/c23-18(14-22-12-6-7-13-22)19-16-10-4-5-11-17(16)21-20(19)15-8-2-1-3-9-15/h1-5,8-11,21H,6-7,12-14H2 |
| InChIKey | GWHPDWDBFKSIQP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |