C20H28N4O4 — CID 2579695
N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetamide (PubChem CID 2579695) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 2579695 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetamide |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)NC(=O)Nc2ccc(C)cc2C)C1=O |
| InChI | InChI=1S/C20H28N4O4/c1-5-9-20(10-6-2)17(26)24(19(28)23-20)12-16(25)22-18(27)21-15-8-7-13(3)11-14(15)4/h7-8,11H,5-6,9-10,12H2,1-4H3,(H,23,28)(H2,21,22,25,27) |
| InChIKey | LMLLLLQKMHEVOZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|