C15H18N4O4 — CID 8014671
N-[(2,4-dimethylphenyl)carbamoyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 8014671) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamoyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8014671 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)CN2C(=O)CN(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C15H18N4O4/c1-9-4-5-11(10(2)6-9)16-14(22)17-12(20)7-19-13(21)8-18(3)15(19)23/h4-6H,7-8H2,1-3H3,(H2,16,17,20,22) |
| InChIKey | JABIIQHDUHGTEA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|