C22H32N4O3 — CID 42154804
2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 42154804) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 42154804 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)Nc2ccc(N3CCCC3)cc2C)C1=O |
| InChI | InChI=1S/C22H32N4O3/c1-4-10-22(11-5-2)20(28)26(21(29)24-22)15-19(27)23-18-9-8-17(14-16(18)3)25-12-6-7-13-25/h8-9,14H,4-7,10-13,15H2,1-3H3,(H,23,27)(H,24,29) |
| InChIKey | RBFSPHSDFNUDTC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|