C24H27ClN4O3 — CID 46606177
2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 46606177) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46606177 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)Nc2ccc(N3CCCC3)cc2C)C1=O |
| InChI | InChI=1S/C24H27ClN4O3/c1-3-24(17-6-8-18(25)9-7-17)22(31)29(23(32)27-24)15-21(30)26-20-11-10-19(14-16(20)2)28-12-4-5-13-28/h6-11,14H,3-5,12-13,15H2,1-2H3,(H,26,30)(H,27,32) |
| InChIKey | UEIGIJABINSZTE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|