C19H26N4O3 — CID 51177673
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 51177673) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 51177673 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2ccccc2N2CCCC2)C1=O |
| InChI | InChI=1S/C19H26N4O3/c1-3-19(4-2)17(25)23(18(26)21-19)13-16(24)20-14-9-5-6-10-15(14)22-11-7-8-12-22/h5-6,9-10H,3-4,7-8,11-13H2,1-2H3,(H,20,24)(H,21,26) |
| InChIKey | NWPNPRJLLAKOEJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|