C21H21N5O6 — CID 41051955
N-[(2,4-dimethylphenyl)carbamoyl]-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 41051955) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamoyl]-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41051955 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)CN2C(=O)N[C@@](C)(c3ccc([N+](=O)[O-])cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H21N5O6/c1-12-4-9-16(13(2)10-12)22-19(29)23-17(27)11-25-18(28)21(3,24-20(25)30)14-5-7-15(8-6-14)26(31)32/h4-10H,11H2,1-3H3,(H,24,30)(H2,22,23,27,29)/t21-/m0/s1 |
| InChIKey | NGKBXBXEMOQMNQ-NRFANRHFSA-N |
| XLogP | 2.33 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|