C23H26N4O5 — CID 40883165
2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-2-nitrophenyl)acetamide (PubChem CID 40883165) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-2-nitrophenyl)acetamide.
| Compound Name | 2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 40883165 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-2-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N[C@@](C)(c3ccc(C(C)(C)C)cc3)C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26N4O5/c1-14-6-11-17(18(12-14)27(31)32)24-19(28)13-26-20(29)23(5,25-21(26)30)16-9-7-15(8-10-16)22(2,3)4/h6-12H,13H2,1-5H3,(H,24,28)(H,25,30)/t23-/m0/s1 |
| InChIKey | OUDHYFCWFVBEDL-QHCPKHFHSA-N |
| XLogP | 3.61 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|