C19H16N4O7 — CID 41001187
2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)acetamide (PubChem CID 41001187) has the molecular formula C19H16N4O7 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 41001187 |
| Molecular Formula | C19H16N4O7 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)acetamide |
| SMILES | C[C@]1(c2ccc3c(c2)OCO3)NC(=O)N(CC(=O)Nc2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C19H16N4O7/c1-19(11-6-7-14-15(8-11)30-10-29-14)17(25)22(18(26)21-19)9-16(24)20-12-4-2-3-5-13(12)23(27)28/h2-8H,9-10H2,1H3,(H,20,24)(H,21,26)/t19-/m1/s1 |
| InChIKey | OKSZGNIBWZTAAO-LJQANCHMSA-N |
| XLogP | 1.73 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|