C23H25N3O5 — CID 7692093
2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-[(2S)-butan-2-yl]phenyl]acetamide (PubChem CID 7692093) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-[(2S)-butan-2-yl]phenyl]acetamide.
| Compound Name | 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-[(2S)-butan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 7692093 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-[(2S)-butan-2-yl]phenyl]acetamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)CN1C(=O)N[C@](C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C23H25N3O5/c1-4-14(2)16-7-5-6-8-17(16)24-20(27)12-26-21(28)23(3,25-22(26)29)15-9-10-18-19(11-15)31-13-30-18/h5-11,14H,4,12-13H2,1-3H3,(H,24,27)(H,25,29)/t14-,23+/m0/s1 |
| InChIKey | ATAHFAATFHCDFK-LFVRLGFBSA-N |
| XLogP | 3.33 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|