C16H25N3O5 — CID 7617522
[2-(cyclopropylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate (PubChem CID 7617522) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7617522 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)OCC(=O)NC2CC2)C1=O |
| InChI | InChI=1S/C16H25N3O5/c1-3-7-16(8-4-2)14(22)19(15(23)18-16)9-13(21)24-10-12(20)17-11-5-6-11/h11H,3-10H2,1-2H3,(H,17,20)(H,18,23) |
| InChIKey | MMWWELMEAOAYRI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|