C12H19N3O5 — CID 119346548
2-[[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-methylamino]acetic acid (PubChem CID 119346548) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 119346548 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-methylamino]acetic acid |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N(C)CC(=O)O)C1=O |
| InChI | InChI=1S/C12H19N3O5/c1-4-12(5-2)10(19)15(11(20)13-12)6-8(16)14(3)7-9(17)18/h4-7H2,1-3H3,(H,13,20)(H,17,18) |
| InChIKey | CNKHBYSFJXCDOB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|