C16H16Cl2N2O3S — CID 35410868
N'-[2-(2,5-dichlorophenoxy)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide (PubChem CID 35410868) has the molecular formula C16H16Cl2N2O3S and a molecular weight of 387.29 g/mol. Its IUPAC name is N'-[2-(2,5-dichlorophenoxy)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2,5-dichlorophenoxy)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 35410868 |
| Molecular Formula | C16H16Cl2N2O3S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | N'-[2-(2,5-dichlorophenoxy)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)COc2cc(Cl)ccc2Cl)cc1C |
| InChI | InChI=1S/C16H16Cl2N2O3S/c1-3-13-9(2)6-14(24-13)16(22)20-19-15(21)8-23-12-7-10(17)4-5-11(12)18/h4-7H,3,8H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | GJDSRIQNNVYMJF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|