C19H20ClN3O3S — CID 9091448
N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide (PubChem CID 9091448) has the molecular formula C19H20ClN3O3S and a molecular weight of 405.91 g/mol. Its IUPAC name is N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9091448 |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2ccc(Cl)cc2N2CCCC2=O)cc1C |
| InChI | InChI=1S/C19H20ClN3O3S/c1-3-15-11(2)9-16(27-15)19(26)22-21-18(25)13-7-6-12(20)10-14(13)23-8-4-5-17(23)24/h6-7,9-10H,3-5,8H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | PDUUMAKOIQDTPB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|