C16H14ClN3O4 — CID 9086885
N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]furan-2-carbohydrazide (PubChem CID 9086885) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]furan-2-carbohydrazide.
| Compound Name | N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9086885 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N'-[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Cl)cc1N1CCCC1=O)c1ccco1 |
| InChI | InChI=1S/C16H14ClN3O4/c17-10-5-6-11(12(9-10)20-7-1-4-14(20)21)15(22)18-19-16(23)13-3-2-8-24-13/h2-3,5-6,8-9H,1,4,7H2,(H,18,22)(H,19,23) |
| InChIKey | QCKUSOPUHHESNS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|