C22H18ClN3O4 — CID 55934138
N-[5-chloro-2-[[3-(2-oxopyrrolidin-1-yl)benzoyl]amino]phenyl]furan-2-carboxamide (PubChem CID 55934138) has the molecular formula C22H18ClN3O4 and a molecular weight of 423.86 g/mol. Its IUPAC name is N-[5-chloro-2-[[3-(2-oxopyrrolidin-1-yl)benzoyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-chloro-2-[[3-(2-oxopyrrolidin-1-yl)benzoyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55934138 |
| Molecular Formula | C22H18ClN3O4 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[5-chloro-2-[[3-(2-oxopyrrolidin-1-yl)benzoyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1NC(=O)c1ccco1)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C22H18ClN3O4/c23-15-8-9-17(18(13-15)25-22(29)19-6-3-11-30-19)24-21(28)14-4-1-5-16(12-14)26-10-2-7-20(26)27/h1,3-6,8-9,11-13H,2,7,10H2,(H,24,28)(H,25,29) |
| InChIKey | TUPNFVYOSRJYIR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |