C17H23ClN4O2S — CID 9093295
1-[[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]amino]-3-pentylthiourea (PubChem CID 9093295) has the molecular formula C17H23ClN4O2S and a molecular weight of 382.92 g/mol. Its IUPAC name is 1-[[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9093295 |
| Molecular Formula | C17H23ClN4O2S |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[[4-chloro-2-(2-oxopyrrolidin-1-yl)benzoyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1ccc(Cl)cc1N1CCCC1=O |
| InChI | InChI=1S/C17H23ClN4O2S/c1-2-3-4-9-19-17(25)21-20-16(24)13-8-7-12(18)11-14(13)22-10-5-6-15(22)23/h7-8,11H,2-6,9-10H2,1H3,(H,20,24)(H2,19,21,25) |
| InChIKey | RTGMEXPCTFKQNB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|