C18H19ClN2O5S — CID 7972763
[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-ethyl-4-methylthiophene-2-carboxylate (PubChem CID 7972763) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-ethyl-4-methylthiophene-2-carboxylate.
| Compound Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-ethyl-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7972763 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-ethyl-4-methylthiophene-2-carboxylate |
| SMILES | CCc1sc(C(=O)OCC(=O)NNC(=O)c2cc(Cl)ccc2OC)cc1C |
| InChI | InChI=1S/C18H19ClN2O5S/c1-4-14-10(2)7-15(27-14)18(24)26-9-16(22)20-21-17(23)12-8-11(19)5-6-13(12)25-3/h5-8H,4,9H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | BSTQDQGJYSJGRC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|