C25H26F3N5O4 — CID 2092747
N-[[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 2092747) has the molecular formula C25H26F3N5O4 and a molecular weight of 517.51 g/mol. Its IUPAC name is N-[[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 2092747 |
| Molecular Formula | C25H26F3N5O4 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | N-[[3-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | COc1cc(C=NNC(=O)Cn2ccc(C(F)(F)F)n2)ccc1OCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H26F3N5O4/c1-15-9-16(2)24(17(3)10-15)30-23(35)14-37-19-6-5-18(11-20(19)36-4)12-29-31-22(34)13-33-8-7-21(32-33)25(26,27)28/h5-12H,13-14H2,1-4H3,(H,30,35)(H,31,34) |
| InChIKey | DMJPGKLHGXFTGF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|