C14H16N6O4 — CID 6862895
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 6862895) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 6862895 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2cncn2)ccc1OCC(N)=O |
| InChI | InChI=1S/C14H16N6O4/c1-23-12-4-10(2-3-11(12)24-7-13(15)21)5-17-19-14(22)6-20-9-16-8-18-20/h2-5,8-9H,6-7H2,1H3,(H2,15,21)(H,19,22)/b17-5+ |
| InChIKey | QRRHLIBCFNAKMM-YAXRCOADSA-N |
| XLogP | -0.70 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|