C13H15N5O3 — CID 5424576
N-[(Z)-(4-ethoxy-3-hydroxyphenyl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 5424576) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[(Z)-(4-ethoxy-3-hydroxyphenyl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(Z)-(4-ethoxy-3-hydroxyphenyl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 5424576 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[(Z)-(4-ethoxy-3-hydroxyphenyl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)Cn2cncn2)cc1O |
| InChI | InChI=1S/C13H15N5O3/c1-2-21-12-4-3-10(5-11(12)19)6-15-17-13(20)7-18-9-14-8-16-18/h3-6,8-9,19H,2,7H2,1H3,(H,17,20)/b15-6- |
| InChIKey | QUVFHZJJMLQHNZ-UUASQNMZSA-N |
| XLogP | 0.53 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|