C10H10N6O — CID 6900253
N-[(E)-pyridin-2-ylmethylideneamino]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 6900253) has the molecular formula C10H10N6O and a molecular weight of 230.23 g/mol. Its IUPAC name is N-[(E)-pyridin-2-ylmethylideneamino]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(E)-pyridin-2-ylmethylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 6900253 |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-[(E)-pyridin-2-ylmethylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)N/N=C/c1ccccn1 |
| InChI | InChI=1S/C10H10N6O/c17-10(6-16-8-11-7-14-16)15-13-5-9-3-1-2-4-12-9/h1-5,7-8H,6H2,(H,15,17)/b13-5+ |
| InChIKey | MUKQHFDFAHZTOV-WLRTZDKTSA-N |
| XLogP | -0.18 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|