C15H15N3O — CID 6138310
3-phenyl-N-[(Z)-pyridin-2-ylmethylideneamino]propanamide (PubChem CID 6138310) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-phenyl-N-[(Z)-pyridin-2-ylmethylideneamino]propanamide.
| Compound Name | 3-phenyl-N-[(Z)-pyridin-2-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 6138310 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-phenyl-N-[(Z)-pyridin-2-ylmethylideneamino]propanamide |
| SMILES | O=C(CCc1ccccc1)N/N=C\c1ccccn1 |
| InChI | InChI=1S/C15H15N3O/c19-15(10-9-13-6-2-1-3-7-13)18-17-12-14-8-4-5-11-16-14/h1-8,11-12H,9-10H2,(H,18,19)/b17-12- |
| InChIKey | QHLYNXNSZLWZSQ-ATVHPVEESA-N |
| XLogP | 2.16 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|