C13H12N4OS — CID 5424100
N-[(Z)-pyridin-2-ylmethylideneamino]-2-pyridin-2-ylsulfanylacetamide (PubChem CID 5424100) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is N-[(Z)-pyridin-2-ylmethylideneamino]-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-[(Z)-pyridin-2-ylmethylideneamino]-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5424100 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-[(Z)-pyridin-2-ylmethylideneamino]-2-pyridin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccccn1)N/N=C\c1ccccn1 |
| InChI | InChI=1S/C13H12N4OS/c18-12(10-19-13-6-2-4-8-15-13)17-16-9-11-5-1-3-7-14-11/h1-9H,10H2,(H,17,18)/b16-9- |
| InChIKey | DFJAYNIDCKJHSA-SXGWCWSVSA-N |
| XLogP | 1.72 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|