C12H11N3OS2 — CID 749028
2-pyridin-2-ylsulfanyl-N-(thiophen-2-ylmethylideneamino)acetamide (PubChem CID 749028) has the molecular formula C12H11N3OS2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfanyl-N-(thiophen-2-ylmethylideneamino)acetamide.
| Compound Name | 2-pyridin-2-ylsulfanyl-N-(thiophen-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 749028 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-pyridin-2-ylsulfanyl-N-(thiophen-2-ylmethylideneamino)acetamide |
| SMILES | O=C(CSc1ccccn1)NN=Cc1cccs1 |
| InChI | InChI=1S/C12H11N3OS2/c16-11(9-18-12-5-1-2-6-13-12)15-14-8-10-4-3-7-17-10/h1-8H,9H2,(H,15,16) |
| InChIKey | DZHUUILHMRRXIV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|