C16H18N4O — CID 123310795
3-(3-methylanilino)-N-(pyridin-2-ylmethylideneamino)propanamide (PubChem CID 123310795) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-(3-methylanilino)-N-(pyridin-2-ylmethylideneamino)propanamide.
| Compound Name | 3-(3-methylanilino)-N-(pyridin-2-ylmethylideneamino)propanamide |
|---|---|
| PubChem CID | 123310795 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-(3-methylanilino)-N-(pyridin-2-ylmethylideneamino)propanamide |
| SMILES | Cc1cccc(NCCC(=O)NN=Cc2ccccn2)c1 |
| InChI | InChI=1S/C16H18N4O/c1-13-5-4-7-14(11-13)18-10-8-16(21)20-19-12-15-6-2-3-9-17-15/h2-7,9,11-12,18H,8,10H2,1H3,(H,20,21) |
| InChIKey | AVUSTMWCVOHJFE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|