C15H14F3N5O2 — CID 2396992
N-[(4-acetamidophenyl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 2396992) has the molecular formula C15H14F3N5O2 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[(4-acetamidophenyl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 2396992 |
| Molecular Formula | C15H14F3N5O2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[(4-acetamidophenyl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=NNC(=O)Cn2ccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H14F3N5O2/c1-10(24)20-12-4-2-11(3-5-12)8-19-21-14(25)9-23-7-6-13(22-23)15(16,17)18/h2-8H,9H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | WNRALSYMLWLUKA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|