C17H20N2O4S — CID 86815081
N-(3-cyclopentylsulfonylphenyl)-2-ethyl-1,3-oxazole-4-carboxamide (PubChem CID 86815081) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-2-ethyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-2-ethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 86815081 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-2-ethyl-1,3-oxazole-4-carboxamide |
| SMILES | CCc1nc(C(=O)Nc2cccc(S(=O)(=O)C3CCCC3)c2)co1 |
| InChI | InChI=1S/C17H20N2O4S/c1-2-16-19-15(11-23-16)17(20)18-12-6-5-9-14(10-12)24(21,22)13-7-3-4-8-13/h5-6,9-11,13H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | GTSDVYYXYWGTAI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |