C23H24N2O3S2 — CID 38304433
2-benzyl-N-(3-cyclopentylsulfonylphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 38304433) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-benzyl-N-(3-cyclopentylsulfonylphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzyl-N-(3-cyclopentylsulfonylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 38304433 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-benzyl-N-(3-cyclopentylsulfonylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Cc2ccccc2)sc1C(=O)Nc1cccc(S(=O)(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C23H24N2O3S2/c1-16-22(29-21(24-16)14-17-8-3-2-4-9-17)23(26)25-18-10-7-13-20(15-18)30(27,28)19-11-5-6-12-19/h2-4,7-10,13,15,19H,5-6,11-12,14H2,1H3,(H,25,26) |
| InChIKey | ZQNHJGFMMBSECX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |