C20H33ClN2O3 — CID 119722905
N-[3-(2-ethoxyethoxymethyl)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119722905) has the molecular formula C20H33ClN2O3 and a molecular weight of 384.95 g/mol. Its IUPAC name is N-[3-(2-ethoxyethoxymethyl)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[3-(2-ethoxyethoxymethyl)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119722905 |
| Molecular Formula | C20H33ClN2O3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[3-(2-ethoxyethoxymethyl)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CCOCCOCc1cccc(NC(=O)CC(C)C2CCCNC2)c1.Cl |
| InChI | InChI=1S/C20H32N2O3.ClH/c1-3-24-10-11-25-15-17-6-4-8-19(13-17)22-20(23)12-16(2)18-7-5-9-21-14-18;/h4,6,8,13,16,18,21H,3,5,7,9-12,14-15H2,1-2H3,(H,22,23);1H |
| InChIKey | UVRTVMSNGDIVHU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|