C19H31NO3 — CID 100723719
(2R)-2-ethoxy-2,4-dimethyl-N-(3-methyl-4-propoxyphenyl)pentanamide (PubChem CID 100723719) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is (2R)-2-ethoxy-2,4-dimethyl-N-(3-methyl-4-propoxyphenyl)pentanamide.
| Compound Name | (2R)-2-ethoxy-2,4-dimethyl-N-(3-methyl-4-propoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 100723719 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (2R)-2-ethoxy-2,4-dimethyl-N-(3-methyl-4-propoxyphenyl)pentanamide |
| SMILES | CCCOc1ccc(NC(=O)[C@@](C)(CC(C)C)OCC)cc1C |
| InChI | InChI=1S/C19H31NO3/c1-7-11-22-17-10-9-16(12-15(17)5)20-18(21)19(6,23-8-2)13-14(3)4/h9-10,12,14H,7-8,11,13H2,1-6H3,(H,20,21)/t19-/m1/s1 |
| InChIKey | LCESIPBYXDJVOJ-LJQANCHMSA-N |
| XLogP | 4.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |