C28H31FN4O4 — CID 118669368
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[4-fluoro-3-(2-morpholin-4-ylethoxy)phenyl]ethynyl]phenyl]urea (PubChem CID 118669368) has the molecular formula C28H31FN4O4 and a molecular weight of 506.58 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[4-fluoro-3-(2-morpholin-4-ylethoxy)phenyl]ethynyl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[4-fluoro-3-(2-morpholin-4-ylethoxy)phenyl]ethynyl]phenyl]urea |
|---|---|
| PubChem CID | 118669368 |
| Molecular Formula | C28H31FN4O4 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[4-fluoro-3-(2-morpholin-4-ylethoxy)phenyl]ethynyl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(C#Cc3ccc(F)c(OCCN4CCOCC4)c3)cc2)no1 |
| InChI | InChI=1S/C28H31FN4O4/c1-28(2,3)25-19-26(32-37-25)31-27(34)30-22-9-6-20(7-10-22)4-5-21-8-11-23(29)24(18-21)36-17-14-33-12-15-35-16-13-33/h6-11,18-19H,12-17H2,1-3H3,(H2,30,31,32,34) |
| InChIKey | PHESNCHSIQUVIV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|