C30H34FN3O3 — CID 159434390
2-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-[2-[4-fluoro-3-(2-piperidin-1-ylethoxy)phenyl]ethynyl]phenyl]acetamide (PubChem CID 159434390) has the molecular formula C30H34FN3O3 and a molecular weight of 503.62 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-[2-[4-fluoro-3-(2-piperidin-1-ylethoxy)phenyl]ethynyl]phenyl]acetamide.
| Compound Name | 2-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-[2-[4-fluoro-3-(2-piperidin-1-ylethoxy)phenyl]ethynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 159434390 |
| Molecular Formula | C30H34FN3O3 |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 2-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-[2-[4-fluoro-3-(2-piperidin-1-ylethoxy)phenyl]ethynyl]phenyl]acetamide |
| SMILES | CC(C)(C)c1cc(CC(=O)Nc2ccc(C#Cc3ccc(F)c(OCCN4CCCCC4)c3)cc2)no1 |
| InChI | InChI=1S/C30H34FN3O3/c1-30(2,3)28-20-25(33-37-28)21-29(35)32-24-12-9-22(10-13-24)7-8-23-11-14-26(31)27(19-23)36-18-17-34-15-5-4-6-16-34/h9-14,19-20H,4-6,15-18,21H2,1-3H3,(H,32,35) |
| InChIKey | VYNZPDRPGJOHTK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|