C29H34IN5O3 — CID 139417936
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[2-iodo-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]ethynyl]phenyl]urea (PubChem CID 139417936) has the molecular formula C29H34IN5O3 and a molecular weight of 627.53 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[2-iodo-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]ethynyl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[2-iodo-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]ethynyl]phenyl]urea |
|---|---|
| PubChem CID | 139417936 |
| Molecular Formula | C29H34IN5O3 |
| Molecular Weight | 627.53 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[2-iodo-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]ethynyl]phenyl]urea |
| SMILES | CN1CCN(CCOc2ccc(C#Cc3ccc(NC(=O)Nc4cc(C(C)(C)C)on4)cc3)c(I)c2)CC1 |
| InChI | InChI=1S/C29H34IN5O3/c1-29(2,3)26-20-27(33-38-26)32-28(36)31-23-10-6-21(7-11-23)5-8-22-9-12-24(19-25(22)30)37-18-17-35-15-13-34(4)14-16-35/h6-7,9-12,19-20H,13-18H2,1-4H3,(H2,31,32,33,36) |
| InChIKey | HLPMYENWIQOZDW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|