C34H43N7O5S2 — CID 144998040
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[10-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-7-thia-2,5,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]ethynyl]phenyl]urea;ethane (PubChem CID 144998040) has the molecular formula C34H43N7O5S2 and a molecular weight of 693.90 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[10-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-7-thia-2,5,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]ethynyl]phenyl]urea;ethane.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[10-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-7-thia-2,5,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]ethynyl]phenyl]urea;ethane |
|---|---|
| PubChem CID | 144998040 |
| Molecular Formula | C34H43N7O5S2 |
| Molecular Weight | 693.90 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[10-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-7-thia-2,5,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]ethynyl]phenyl]urea;ethane |
| SMILES | CC.CC.CC(C)(C)c1cc(NC(=O)Nc2ccc(C#Cc3cn4c(n3)sc3cc(OCCN5CCS(=O)(=O)CC5)cnc34)cc2)no1 |
| InChI | InChI=1S/C30H31N7O5S2.2C2H6/c1-30(2,3)25-17-26(35-42-25)34-28(38)32-21-7-4-20(5-8-21)6-9-22-19-37-27-24(43-29(37)33-22)16-23(18-31-27)41-13-10-36-11-14-44(39,40)15-12-36;2*1-2/h4-5,7-8,16-19H,10-15H2,1-3H3,(H2,32,34,35,38);2*1-2H3 |
| InChIKey | ZOXNLJLEDZGBFL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.90 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|