C29H33FN4O4 — CID 118665886
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]phenyl]urea (PubChem CID 118665886) has the molecular formula C29H33FN4O4 and a molecular weight of 520.61 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]phenyl]urea |
|---|---|
| PubChem CID | 118665886 |
| Molecular Formula | C29H33FN4O4 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(C#Cc3ccc(OCCCN4CCOCC4)c(F)c3)cc2)no1 |
| InChI | InChI=1S/C29H33FN4O4/c1-29(2,3)26-20-27(33-38-26)32-28(35)31-23-10-7-21(8-11-23)5-6-22-9-12-25(24(30)19-22)37-16-4-13-34-14-17-36-18-15-34/h7-12,19-20H,4,13-18H2,1-3H3,(H2,31,32,33,35) |
| InChIKey | YXQGJGKFASWRSC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|