C32H42N6O4 — CID 144998041
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(Z)-3-methanimidoyl-4-[4-(3-morpholin-4-ylpropoxy)-1H-pyrrol-2-yl]but-3-en-1-ynyl]phenyl]urea;ethane (PubChem CID 144998041) has the molecular formula C32H42N6O4 and a molecular weight of 574.73 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(Z)-3-methanimidoyl-4-[4-(3-morpholin-4-ylpropoxy)-1H-pyrrol-2-yl]but-3-en-1-ynyl]phenyl]urea;ethane.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(Z)-3-methanimidoyl-4-[4-(3-morpholin-4-ylpropoxy)-1H-pyrrol-2-yl]but-3-en-1-ynyl]phenyl]urea;ethane |
|---|---|
| PubChem CID | 144998041 |
| Molecular Formula | C32H42N6O4 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(Z)-3-methanimidoyl-4-[4-(3-morpholin-4-ylpropoxy)-1H-pyrrol-2-yl]but-3-en-1-ynyl]phenyl]urea;ethane |
| SMILES | CC.[H]/N=C/C(C#Cc1ccc(NC(=O)Nc2cc(C(C)(C)C)on2)cc1)=C\c1cc(OCCCN2CCOCC2)c[nH]1 |
| InChI | InChI=1S/C30H36N6O4.C2H6/c1-30(2,3)27-19-28(35-40-27)34-29(37)33-24-9-7-22(8-10-24)5-6-23(20-31)17-25-18-26(21-32-25)39-14-4-11-36-12-15-38-16-13-36;1-2/h7-10,17-21,31-32H,4,11-16H2,1-3H3,(H2,33,34,35,37);1-2H3/b23-17-,31-20+; |
| InChIKey | MBNLHONHIKQDNQ-WLXVGZSRSA-N |
| XLogP | 6.16 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|