C25H33N7 — CID 142697986
5-[3-[3-(dimethylamino)phenyl]phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 142697986) has the molecular formula C25H33N7 and a molecular weight of 431.59 g/mol. Its IUPAC name is 5-[3-[3-(dimethylamino)phenyl]phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-[3-[3-(dimethylamino)phenyl]phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142697986 |
| Molecular Formula | C25H33N7 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 5-[3-[3-(dimethylamino)phenyl]phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | CN(C)c1cccc(-c2cccc(-c3cnc(N)nc3NCCCN3CCNCC3)c2)c1 |
| InChI | InChI=1S/C25H33N7/c1-31(2)22-9-4-7-20(17-22)19-6-3-8-21(16-19)23-18-29-25(26)30-24(23)28-10-5-13-32-14-11-27-12-15-32/h3-4,6-9,16-18,27H,5,10-15H2,1-2H3,(H3,26,28,29,30) |
| InChIKey | AZHPJIRWIIRKCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|