C21H22N4O3 — CID 177379120
4-[6-[2-methoxy-5-(propan-2-ylamino)anilino]pyrazin-2-yl]benzoic acid (PubChem CID 177379120) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-[6-[2-methoxy-5-(propan-2-ylamino)anilino]pyrazin-2-yl]benzoic acid.
| Compound Name | 4-[6-[2-methoxy-5-(propan-2-ylamino)anilino]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 177379120 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-[6-[2-methoxy-5-(propan-2-ylamino)anilino]pyrazin-2-yl]benzoic acid |
| SMILES | COc1ccc(NC(C)C)cc1Nc1cncc(-c2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C21H22N4O3/c1-13(2)23-16-8-9-19(28-3)17(10-16)24-20-12-22-11-18(25-20)14-4-6-15(7-5-14)21(26)27/h4-13,23H,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | AVPJUFLLTXXDII-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|