C20H26N4O3 — CID 143250214
2-N-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine (PubChem CID 143250214) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-N-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine.
| Compound Name | 2-N-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 143250214 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-N-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine |
| SMILES | C/C=C\C(=C/CC)Nc1cncc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C20H26N4O3/c1-6-8-14(9-7-2)22-18-12-21-13-19(24-18)23-15-10-16(25-3)20(27-5)17(11-15)26-4/h6,8-13H,7H2,1-5H3,(H2,22,23,24)/b8-6-,14-9+ |
| InChIKey | PRWFCZJCVMPPSD-CURXYISGSA-N |
| XLogP | 4.53 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|