C19H26N4O4 — CID 113050576
2-ethyl-N-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]butanamide (PubChem CID 113050576) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-ethyl-N-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]butanamide.
| Compound Name | 2-ethyl-N-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]butanamide |
|---|---|
| PubChem CID | 113050576 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-ethyl-N-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(Nc2cc(OC)c(OC)c(OC)c2)nn1 |
| InChI | InChI=1S/C19H26N4O4/c1-6-12(7-2)19(24)21-17-9-8-16(22-23-17)20-13-10-14(25-3)18(27-5)15(11-13)26-4/h8-12H,6-7H2,1-5H3,(H,20,22)(H,21,23,24) |
| InChIKey | VBRPFBCIMVBNRC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |