C18H22N2O4 — CID 112989467
N-[4-(3,4,5-trimethoxyanilino)phenyl]propanamide (PubChem CID 112989467) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[4-(3,4,5-trimethoxyanilino)phenyl]propanamide.
| Compound Name | N-[4-(3,4,5-trimethoxyanilino)phenyl]propanamide |
|---|---|
| PubChem CID | 112989467 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[4-(3,4,5-trimethoxyanilino)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-5-17(21)20-13-8-6-12(7-9-13)19-14-10-15(22-2)18(24-4)16(11-14)23-3/h6-11,19H,5H2,1-4H3,(H,20,21) |
| InChIKey | CHMLLVVWVQSJRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |