C19H25N3O5 — CID 123370060
N-[2-(hydroxymethyl)-5-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]phenyl]propanamide (PubChem CID 123370060) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-5-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]phenyl]propanamide.
| Compound Name | N-[2-(hydroxymethyl)-5-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]phenyl]propanamide |
|---|---|
| PubChem CID | 123370060 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[2-(hydroxymethyl)-5-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(NNc2cc(OC)c(OC)c(OC)c2)ccc1CO |
| InChI | InChI=1S/C19H25N3O5/c1-5-18(24)20-15-8-13(7-6-12(15)11-23)21-22-14-9-16(25-2)19(27-4)17(10-14)26-3/h6-10,21-23H,5,11H2,1-4H3,(H,20,24) |
| InChIKey | SQWXTLBDEXVHSC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|