C16H17F3N4O — CID 113051469
2-ethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]butanamide (PubChem CID 113051469) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-ethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]butanamide.
| Compound Name | 2-ethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]butanamide |
|---|---|
| PubChem CID | 113051469 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-ethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(Nc2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C16H17F3N4O/c1-3-9(4-2)16(24)21-13-8-7-12(22-23-13)20-11-6-5-10(17)14(18)15(11)19/h5-9H,3-4H2,1-2H3,(H,20,22)(H,21,23,24) |
| InChIKey | LKUNAGJQKKCBFI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|